CAS 1453315-76-8 appears in our catalog under these names: 7-Amino-5-thia-2-azaspiro[3.4]octane-2-carboxylic acid-5,5-dioxide 1,1-dimethylethyl ester, 95%, 5-Thia-2-azaspiro(3.4)octane-2-carboxylic acid, 7-amino-, 1,1-dimethylethyl ester, 5,5-dioxide, 95-<97%, tert-Butyl 7-amino-5-thia-2-azaspiro(3.4)octane-2-carboxylate 5,5-dioxide, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 250mg, 100mg, 500mg, 1g, 2,5g, 5g.
Tert-butyl 7-amino-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1453315-76-8) is a chemical compound with the molecular formula C11H20N2O4S and a molecular weight of 276.35 g/mol. IUPAC name: tert-butyl 7-amino-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: HIXKKZAKBLIEPB-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4S |
|---|---|
| Molecular weight | 276.35 g/mol |
| IUPAC name | tert-butyl 7-amino-5,5-dioxo-5lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | HIXKKZAKBLIEPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(CS2(=O)=O)N |
Computed by PubChem (NCBI)