CAS 1092346-02-5 is the registry number for 4-Destrifluoromethyl-6-trifluoromethyl Flonicamid. Offered by: TRC. Available pack sizes: 250mg.
N-(cyanomethyl)-6-(trifluoromethyl)pyridine-3-carboxamide (CAS 1092346-02-5) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: N-(cyanomethyl)-6-(trifluoromethyl)pyridine-3-carboxamide. InChIKey: UZRXDWJOQHGEBR-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | N-(cyanomethyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| InChIKey | UZRXDWJOQHGEBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)NCC#N)C(F)(F)F |
Computed by PubChem (NCBI)