Products 1092347-24-4
CAS 1092347-24-4 is the registry number for 4-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-5-fluoro-2,3-dihydroinden-1-one (CAS 1092347-24-4) is a chemical compound with the molecular formula C9H6ClFO and a molecular weight of 184.59 g/mol. IUPAC name: 4-chloro-5-fluoro-2,3-dihydroinden-1-one. InChIKey: MELSEKLTYOIGMY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO |
|---|---|
| Molecular weight | 184.59 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | MELSEKLTYOIGMY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)