CAS 1092349-75-1 is the registry number for 3,4-Bis(trifluoromethyl)fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-fluoro-1,2-bis(trifluoromethyl)benzene (CAS 1092349-75-1) is a chemical compound with the molecular formula C8H3F7 and a molecular weight of 232.10 g/mol. IUPAC name: 4-fluoro-1,2-bis(trifluoromethyl)benzene. InChIKey: ITNYISOJCVKBSZ-UHFFFAOYSA-N.
| Molecular formula | C8H3F7 |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 4-fluoro-1,2-bis(trifluoromethyl)benzene |
| InChIKey | ITNYISOJCVKBSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)