CAS 35564-19-3 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)fluorobenzene, 98%, 3,5-Bis-(trifluoromethyl)fluorobenzene, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
1-fluoro-3,5-bis(trifluoromethyl)benzene (CAS 35564-19-3) is a chemical compound with the molecular formula C8H3F7 and a molecular weight of 232.10 g/mol. IUPAC name: 1-fluoro-3,5-bis(trifluoromethyl)benzene. InChIKey: ZBVDOILFQLAMEJ-UHFFFAOYSA-N.
| Molecular formula | C8H3F7 |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 1-fluoro-3,5-bis(trifluoromethyl)benzene |
| InChIKey | ZBVDOILFQLAMEJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)