CAS 887268-08-8 is the registry number for 2,5-Bis(trifluoromethyl)fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-1,4-bis(trifluoromethyl)benzene (CAS 887268-08-8) is a chemical compound with the molecular formula C8H3F7 and a molecular weight of 232.10 g/mol. IUPAC name: 2-fluoro-1,4-bis(trifluoromethyl)benzene. InChIKey: KAGRJEBZBWYSJK-UHFFFAOYSA-N.
| Molecular formula | C8H3F7 |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2-fluoro-1,4-bis(trifluoromethyl)benzene |
| InChIKey | KAGRJEBZBWYSJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)