CAS 1099597-20-2 is the registry number for 1-Fluoro-2,3-bis-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-fluoro-2,3-bis(trifluoromethyl)benzene (CAS 1099597-20-2) is a chemical compound with the molecular formula C8H3F7 and a molecular weight of 232.10 g/mol. IUPAC name: 1-fluoro-2,3-bis(trifluoromethyl)benzene. InChIKey: CDXIPPDZGNMJCD-UHFFFAOYSA-N.
| Molecular formula | C8H3F7 |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 1-fluoro-2,3-bis(trifluoromethyl)benzene |
| InChIKey | CDXIPPDZGNMJCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)