CAS 778-35-8 is the registry number for 4-Methylheptafluorotoluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2,4,5-tetrafluoro-3-methyl-6-(trifluoromethyl)benzene (CAS 778-35-8) is a chemical compound with the molecular formula C8H3F7 and a molecular weight of 232.10 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-methyl-6-(trifluoromethyl)benzene. InChIKey: JBZHWNXMZYBXDQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F7 |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-methyl-6-(trifluoromethyl)benzene |
| InChIKey | JBZHWNXMZYBXDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)C(F)(F)F)F)F |
Computed by PubChem (NCBI)