CAS 1092460-41-7 is the registry number for Methyl 2-hydroxy-4-(2,2,2-trifluoroacetamido)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 50mg.
Methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate (CAS 1092460-41-7) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate. InChIKey: COVMHYLZUSIQMC-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO4 |
|---|---|
| Molecular weight | 263.17 g/mol |
| IUPAC name | methyl 2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| InChIKey | COVMHYLZUSIQMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)NC(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)