CAS 1360944-09-7 appears in our catalog under these names: Dimethyl 3-(trifluoromethyl)pyridine-2,5-dicarboxylate, 95%, Dimethyl 3-(trifluoromethyl)pyridine-2,5-dicarboxylate, 97%, Dimethyl 3–(trifluoromethyl)pyridine–2,5–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Dimethyl 3-(trifluoromethyl)pyridine-2,5-dicarboxylate (CAS 1360944-09-7) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: dimethyl 3-(trifluoromethyl)pyridine-2,5-dicarboxylate. InChIKey: ZPEVKRYZDQEQDY-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO4 |
|---|---|
| Molecular weight | 263.17 g/mol |
| IUPAC name | dimethyl 3-(trifluoromethyl)pyridine-2,5-dicarboxylate |
| InChIKey | ZPEVKRYZDQEQDY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)