CAS 1214332-64-5 is the registry number for Ethyl 5-nitro-2-(trifluoromethyl)benzoate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Ethyl 5-nitro-2-(trifluoromethyl)benzoate (CAS 1214332-64-5) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: ethyl 5-nitro-2-(trifluoromethyl)benzoate. InChIKey: UGMVRTZLPSXUBC-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO4 |
|---|---|
| Molecular weight | 263.17 g/mol |
| IUPAC name | ethyl 5-nitro-2-(trifluoromethyl)benzoate |
| InChIKey | UGMVRTZLPSXUBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)