Products 915094-38-1

CAS 915094-38-1 is the registry number for 4-Methoxy-3-(2,2,2-trifluoroacetamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid (CAS 915094-38-1) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: 4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid. InChIKey: OBBPEWRCSVGXMR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F3NO4
Molecular weight263.17 g/mol
IUPAC name4-methoxy-3-[(2,2,2-trifluoroacetyl)amino]benzoic acid
InChIKeyOBBPEWRCSVGXMR-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)