CAS 1806545-27-6 is the registry number for methyl 2-[4-nitro-2-(trifluoromethyl)phenyl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-[4-nitro-2-(trifluoromethyl)phenyl]acetate (CAS 1806545-27-6) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: methyl 2-[4-nitro-2-(trifluoromethyl)phenyl]acetate. InChIKey: XWJUAOQDPPDTSV-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO4 |
|---|---|
| Molecular weight | 263.17 g/mol |
| IUPAC name | methyl 2-[4-nitro-2-(trifluoromethyl)phenyl]acetate |
| InChIKey | XWJUAOQDPPDTSV-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)