CAS 1092460-66-6 appears in our catalog under these names: 3-(3-(Difluoromethoxy)phenyl)propionic acid, 3-(3-(Difluoromethoxy)phenyl)propanoic acid, 97%, 97%, 3-[3-(Difluoromethoxy)phenyl]propionic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 500mg, 1g, 2.5g.
3-[3-(difluoromethoxy)phenyl]propanoic acid (CAS 1092460-66-6) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 3-[3-(difluoromethoxy)phenyl]propanoic acid. InChIKey: GWTSEGFRVOHJSG-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 3-[3-(difluoromethoxy)phenyl]propanoic acid |
| InChIKey | GWTSEGFRVOHJSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)CCC(=O)O |
Computed by PubChem (NCBI)