Products 1092461-32-9
CAS 1092461-32-9 appears in our catalog under these names: 3-Ethoxy-2,6-difluorophenylacetic acid, 95%, 3-Ethoxy-2,6-difluorophenylacetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(3-ethoxy-2,6-difluorophenyl)acetic acid (CAS 1092461-32-9) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 2-(3-ethoxy-2,6-difluorophenyl)acetic acid. InChIKey: CXLCGFWZQHJZNB-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 2-(3-ethoxy-2,6-difluorophenyl)acetic acid |
| InChIKey | CXLCGFWZQHJZNB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)CC(=O)O)F |
Computed by PubChem (NCBI)