Products 1092507-01-1

CAS 1092507-01-1 is the registry number for 2-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetic acid (CAS 1092507-01-1) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetic acid. InChIKey: STJFPPKIYLSEKU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O3
Molecular weight218.25 g/mol
IUPAC name2-(2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl)acetic acid
InChIKeySTJFPPKIYLSEKU-UHFFFAOYSA-N
SMILESC1CC2=C(C1CC(=O)O)C3=C(C=C2)OCC3

Computed by PubChem (NCBI)