CAS 1092507-02-2 is the registry number for Ramelteon Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid (CAS 1092507-02-2) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid. InChIKey: STJFPPKIYLSEKU-VIFPVBQESA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid |
| InChIKey | STJFPPKIYLSEKU-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@@H]1CC(=O)O)C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)