CAS 1092523-22-2 is the registry number for 6-Chloro-2-(ethylamino)pyridine-3-carbonyl Fluoride. Offered by: TRC. Available pack sizes: 100mg, 1g.
6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride (CAS 1092523-22-2) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride. InChIKey: AWDGTGJSUKXFHC-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride |
| InChIKey | AWDGTGJSUKXFHC-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=CC(=N1)Cl)C(=O)F |
Computed by PubChem (NCBI)