Products 1092523-22-2

CAS 1092523-22-2 is the registry number for 6-Chloro-2-(ethylamino)pyridine-3-carbonyl Fluoride. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride (CAS 1092523-22-2) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride. InChIKey: AWDGTGJSUKXFHC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFN2O
Molecular weight202.61 g/mol
IUPAC name6-chloro-2-(ethylamino)pyridine-3-carbonyl fluoride
InChIKeyAWDGTGJSUKXFHC-UHFFFAOYSA-N
SMILESCCNC1=C(C=CC(=N1)Cl)C(=O)F

Computed by PubChem (NCBI)