CAS 306937-33-7 is the registry number for 2-(2-Chloro-4-fluorophenyl)-n'-hydroxyethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-chloro-4-fluorophenyl)-N'-hydroxyethanimidamide (CAS 306937-33-7) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenyl)-N'-hydroxyethanimidamide. InChIKey: ZRXMHYFYQBAPGT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | ZRXMHYFYQBAPGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C/C(=N/O)/N |
Computed by PubChem (NCBI)