CAS 1863285-91-9 is the registry number for 2-Chloro-3-fluoro-n,n-dimethylpyridine-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-3-fluoro-N,N-dimethylpyridine-4-carboxamide (CAS 1863285-91-9) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 2-chloro-3-fluoro-N,N-dimethylpyridine-4-carboxamide. InChIKey: MLYIYZPXQVUGBH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 2-chloro-3-fluoro-N,N-dimethylpyridine-4-carboxamide |
| InChIKey | MLYIYZPXQVUGBH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=NC=C1)Cl)F |
Computed by PubChem (NCBI)