CAS 1214238-11-5 is the registry number for 3-Amino-5-fluoro-1,3-dihydro-2h-indol-2-one hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
3-amino-5-fluoro-1,3-dihydroindol-2-one;hydrochloride (CAS 1214238-11-5) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 3-amino-5-fluoro-1,3-dihydroindol-2-one;hydrochloride. InChIKey: IYSPEEOQVUUCEM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-amino-5-fluoro-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | IYSPEEOQVUUCEM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)