Products 1694174-35-0
CAS 1694174-35-0 is the registry number for 2-Chloro-n-ethyl-5-fluoronicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-N-ethyl-5-fluoropyridine-3-carboxamide (CAS 1694174-35-0) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 2-chloro-N-ethyl-5-fluoropyridine-3-carboxamide. InChIKey: JDMWCYXVJQWUQZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 2-chloro-N-ethyl-5-fluoropyridine-3-carboxamide |
| InChIKey | JDMWCYXVJQWUQZ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(N=CC(=C1)F)Cl |
Computed by PubChem (NCBI)