Products 1092789-65-5

CAS 1092789-65-5 is the registry number for 3-(benzyloxy)-4-chlorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-chloro-3-phenylmethoxybenzoic acid (CAS 1092789-65-5) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 4-chloro-3-phenylmethoxybenzoic acid. InChIKey: PLDXZFVBUSZFBR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO3
Molecular weight262.69 g/mol
IUPAC name4-chloro-3-phenylmethoxybenzoic acid
InChIKeyPLDXZFVBUSZFBR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=CC(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)