CAS 1093072-92-4 appears in our catalog under these names: Methyl (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate, 95%, Methyl (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Methyl (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (CAS 1093072-92-4) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: methyl (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate. InChIKey: XZQPYCYGHNQRTE-BBFKJOKFSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | methyl (2S,4R)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| InChIKey | XZQPYCYGHNQRTE-BBFKJOKFSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1C(=O)C23CC4CC(C2)CC(C4)C3)O |
Computed by PubChem (NCBI)