Products 1093938-80-7

CAS 1093938-80-7 is the registry number for Methyl 5-(2-aminoethyl)-2-methoxybenzoate hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Methyl 5-(2-aminoethyl)-2-methoxybenzoate;hydrochloride (CAS 1093938-80-7) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: methyl 5-(2-aminoethyl)-2-methoxybenzoate;hydrochloride. InChIKey: RNLVERHHUIYMEM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO3
Molecular weight245.70 g/mol
IUPAC namemethyl 5-(2-aminoethyl)-2-methoxybenzoate;hydrochloride
InChIKeyRNLVERHHUIYMEM-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CCN)C(=O)OC.Cl

Computed by PubChem (NCBI)