CAS 1094251-98-5 is the registry number for 2-(2-Chlorophenyl)-1-(thiophen-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(2-chlorophenyl)-1-thiophen-2-ylethanone (CAS 1094251-98-5) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-thiophen-2-ylethanone. InChIKey: MSIPVKLMJDXETE-UHFFFAOYSA-N.
| Molecular formula | C12H9ClOS |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-thiophen-2-ylethanone |
| InChIKey | MSIPVKLMJDXETE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)C2=CC=CS2)Cl |
Computed by PubChem (NCBI)