Products 1151512-19-4

CAS 1151512-19-4 is the registry number for 4-(Thien-2-ylmethyl)benzoyl chloride, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(thiophen-2-ylmethyl)benzoyl chloride (CAS 1151512-19-4) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 4-(thiophen-2-ylmethyl)benzoyl chloride. InChIKey: AOHWXUBTRWZCOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClOS
Molecular weight236.72 g/mol
IUPAC name4-(thiophen-2-ylmethyl)benzoyl chloride
InChIKeyAOHWXUBTRWZCOZ-UHFFFAOYSA-N
SMILESC1=CSC(=C1)CC2=CC=C(C=C2)C(=O)Cl

Computed by PubChem (NCBI)