CAS 1151512-19-4 is the registry number for 4-(Thien-2-ylmethyl)benzoyl chloride, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.
4-(thiophen-2-ylmethyl)benzoyl chloride (CAS 1151512-19-4) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 4-(thiophen-2-ylmethyl)benzoyl chloride. InChIKey: AOHWXUBTRWZCOZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClOS |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 4-(thiophen-2-ylmethyl)benzoyl chloride |
| InChIKey | AOHWXUBTRWZCOZ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)