CAS 893735-05-2 appears in our catalog under these names: 1-(5-(2-Chlorophenyl)thiophen-2-yl)ethanone, 97%, 1-(5-(2-Chlorophenyl)thiophen-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
1-[5-(2-chlorophenyl)thiophen-2-yl]ethanone (CAS 893735-05-2) is a chemical compound with the molecular formula C12H9ClOS and a molecular weight of 236.72 g/mol. IUPAC name: 1-[5-(2-chlorophenyl)thiophen-2-yl]ethanone. InChIKey: BFYUAUAWCRMZSS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClOS |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 1-[5-(2-chlorophenyl)thiophen-2-yl]ethanone |
| InChIKey | BFYUAUAWCRMZSS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)