Products 1094292-46-2
CAS 1094292-46-2 is the registry number for 2-Chloro-4,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-4,5-dimethoxybenzenesulfonyl chloride (CAS 1094292-46-2) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 2-chloro-4,5-dimethoxybenzenesulfonyl chloride. InChIKey: MDJHQHAIBSOFAM-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O4S |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 2-chloro-4,5-dimethoxybenzenesulfonyl chloride |
| InChIKey | MDJHQHAIBSOFAM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1OC)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)