Products 78046-28-3

CAS 78046-28-3 is the registry number for 5-Chloro-2,4-dimethoxybenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-chloro-2,4-dimethoxybenzenesulfonyl chloride (CAS 78046-28-3) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 5-chloro-2,4-dimethoxybenzenesulfonyl chloride. InChIKey: HXTZVKXMOKCJPE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O4S
Molecular weight271.12 g/mol
IUPAC name5-chloro-2,4-dimethoxybenzenesulfonyl chloride
InChIKeyHXTZVKXMOKCJPE-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)OC

Computed by PubChem (NCBI)