CAS 78046-28-3 is the registry number for 5-Chloro-2,4-dimethoxybenzenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-2,4-dimethoxybenzenesulfonyl chloride (CAS 78046-28-3) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 5-chloro-2,4-dimethoxybenzenesulfonyl chloride. InChIKey: HXTZVKXMOKCJPE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O4S |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 5-chloro-2,4-dimethoxybenzenesulfonyl chloride |
| InChIKey | HXTZVKXMOKCJPE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1S(=O)(=O)Cl)Cl)OC |
Computed by PubChem (NCBI)