CAS 2228560-96-9 is the registry number for 2-Chloro-3,4-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3,4-dimethoxybenzenesulfonyl chloride (CAS 2228560-96-9) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 2-chloro-3,4-dimethoxybenzenesulfonyl chloride. InChIKey: IELDPKPYLYYTSH-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O4S |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 2-chloro-3,4-dimethoxybenzenesulfonyl chloride |
| InChIKey | IELDPKPYLYYTSH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)Cl)Cl)OC |
Computed by PubChem (NCBI)