Products 2228560-96-9

CAS 2228560-96-9 is the registry number for 2-Chloro-3,4-dimethoxybenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-3,4-dimethoxybenzenesulfonyl chloride (CAS 2228560-96-9) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 2-chloro-3,4-dimethoxybenzenesulfonyl chloride. InChIKey: IELDPKPYLYYTSH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O4S
Molecular weight271.12 g/mol
IUPAC name2-chloro-3,4-dimethoxybenzenesulfonyl chloride
InChIKeyIELDPKPYLYYTSH-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)S(=O)(=O)Cl)Cl)OC

Computed by PubChem (NCBI)