Products 98546-13-5

CAS 98546-13-5 appears in our catalog under these names: 4-Chloro-2,5-dimethoxybenzenesulfonyl chloride, 95%, 4-Chloro-2,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g.

Structural formula: {0} (CAS {1})

4-chloro-2,5-dimethoxybenzenesulfonyl chloride (CAS 98546-13-5) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 4-chloro-2,5-dimethoxybenzenesulfonyl chloride. InChIKey: KTSIEOKJPDDBPC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O4S
Molecular weight271.12 g/mol
IUPAC name4-chloro-2,5-dimethoxybenzenesulfonyl chloride
InChIKeyKTSIEOKJPDDBPC-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1Cl)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)