CAS 145980-90-1 appears in our catalog under these names: 3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride, 3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-chloro-2,6-dimethoxybenzenesulfonyl chloride (CAS 145980-90-1) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 3-chloro-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: JOJNRDCALXLXJY-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O4S |
|---|---|
| Molecular weight | 271.12 g/mol |
| IUPAC name | 3-chloro-2,6-dimethoxybenzenesulfonyl chloride |
| InChIKey | JOJNRDCALXLXJY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)