Products 145980-90-1

CAS 145980-90-1 appears in our catalog under these names: 3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride, 3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

3-chloro-2,6-dimethoxybenzenesulfonyl chloride (CAS 145980-90-1) is a chemical compound with the molecular formula C8H8Cl2O4S and a molecular weight of 271.12 g/mol. IUPAC name: 3-chloro-2,6-dimethoxybenzenesulfonyl chloride. InChIKey: JOJNRDCALXLXJY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O4S
Molecular weight271.12 g/mol
IUPAC name3-chloro-2,6-dimethoxybenzenesulfonyl chloride
InChIKeyJOJNRDCALXLXJY-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)Cl)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)