Products 1094293-77-2
CAS 1094293-77-2 appears in our catalog under these names: 2-[2-(2,3-Dichlorophenyl)-1,3-thiazol-4-yl]acetic acid, 95%, 2-(2-(2,3-DIchlorophenyl)-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 1094293-77-2) is a chemical compound with the molecular formula C11H7Cl2NO2S and a molecular weight of 288.1 g/mol. IUPAC name: 2-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: UZKQYIRJKQFPBU-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | 2-[2-(2,3-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | UZKQYIRJKQFPBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)