CAS 1971791-39-5 is the registry number for Methyl 2-(2,5-dichlorophenyl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate (CAS 1971791-39-5) is a chemical compound with the molecular formula C11H7Cl2NO2S and a molecular weight of 288.1 g/mol. IUPAC name: methyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate. InChIKey: JHJPEIKKJLVCQR-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | methyl 2-(2,5-dichlorophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | JHJPEIKKJLVCQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)