Products 17969-29-8
CAS 17969-29-8 appears in our catalog under these names: 2-[2-(2,4-Dichlorophenyl)-1,3-thiazol-4-yl]acetic acid, 95%, 2-(2-(2,4-Dichlorophenyl)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(2,4-Dichlorophenyl)-1,3-thiazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid (CAS 17969-29-8) is a chemical compound with the molecular formula C11H7Cl2NO2S and a molecular weight of 288.1 g/mol. IUPAC name: 2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid. InChIKey: XSZXHVFNMYQPOI-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | 2-[2-(2,4-dichlorophenyl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | XSZXHVFNMYQPOI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)