CAS 472804-18-5 appears in our catalog under these names: 2-(2,4-Dichlorophenyl)-4-methylthiazole-5-carboxylic acid, 2-(2,4-Dichlorophenyl)-4-methylthiazole-5-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 472804-18-5) is a chemical compound with the molecular formula C11H7Cl2NO2S and a molecular weight of 288.1 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: ZEQMLJVLQKBPNX-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | ZEQMLJVLQKBPNX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)