Products 1216305-01-9
CAS 1216305-01-9 is the registry number for 2-(3,4-Dichlorobenzyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid (CAS 1216305-01-9) is a chemical compound with the molecular formula C11H7Cl2NO2S and a molecular weight of 288.1 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: XOWFAJQQPQTPEY-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2S |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | XOWFAJQQPQTPEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=NC(=CS2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)