Products 1094310-78-7
CAS 1094310-78-7 appears in our catalog under these names: 5-Chloro-2-(cyclopentyloxy)benzoic acid, 95%, 5-Chloro-2-(cyclopentyloxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-chloro-2-cyclopentyloxybenzoic acid (CAS 1094310-78-7) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: 5-chloro-2-cyclopentyloxybenzoic acid. InChIKey: KVRMMVXGHWBEBK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 5-chloro-2-cyclopentyloxybenzoic acid |
| InChIKey | KVRMMVXGHWBEBK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)