CAS 1094316-25-2 appears in our catalog under these names: 4-((1,1-Dioxo-1,2-benzothiazol-3-yl)(methyl)amino)butanoic acid, 95%, 4-((1,1-Dioxo-1,2-benzothiazol-3-yl)(methyl)amino)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]butanoic acid (CAS 1094316-25-2) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]butanoic acid. InChIKey: BNSXBJKKUDQORL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]butanoic acid |
| InChIKey | BNSXBJKKUDQORL-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)C1=NS(=O)(=O)C2=CC=CC=C21 |
Computed by PubChem (NCBI)