CAS 87657-41-8 is the registry number for (3S)-3-Mercapto-1-pyrrolidinecarboxylic Acid (4-Nitrophenyl)methyl Ester. Offered by: TRC. Available pack sizes: 5g.
(4-nitrophenyl)methyl (3S)-3-sulfanylpyrrolidine-1-carboxylate (CAS 87657-41-8) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: (4-nitrophenyl)methyl (3S)-3-sulfanylpyrrolidine-1-carboxylate. InChIKey: ZVAPAKFZITWAHK-NSHDSACASA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | (4-nitrophenyl)methyl (3S)-3-sulfanylpyrrolidine-1-carboxylate |
| InChIKey | ZVAPAKFZITWAHK-NSHDSACASA-N |
| SMILES | C1CN(C[C@H]1S)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)