CAS 934236-31-4 appears in our catalog under these names: 5-Methylsulfamoylmethyl-1h-indole-3-carboxylic acid methyl ester, 95%, 5-Methylsulfamoylmethyl-1H-indole-3-carboxylic acid methyl ester, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl 5-(methylsulfamoylmethyl)-1H-indole-3-carboxylate (CAS 934236-31-4) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: methyl 5-(methylsulfamoylmethyl)-1H-indole-3-carboxylate. InChIKey: JRJRWJDETARUGU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | methyl 5-(methylsulfamoylmethyl)-1H-indole-3-carboxylate |
| InChIKey | JRJRWJDETARUGU-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC2=C(C=C1)NC=C2C(=O)OC |
Computed by PubChem (NCBI)