CAS 1396968-55-0 appears in our catalog under these names: 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]-3-methylbutanoic acid, 95%, 2-((1,1-Dioxido-1,2-benzisothiazol-3-yl)amino)-3-methylbutanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoic acid (CAS 1396968-55-0) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoic acid. InChIKey: SFZLNKSTEANLGU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoic acid |
| InChIKey | SFZLNKSTEANLGU-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N=C1C2=CC=CC=C2S(=O)(=O)N1 |
Computed by PubChem (NCBI)