CAS 1274709-91-9 is the registry number for 2-(2,5-Dioxo-4-(propan-2-yl)-4-(thiophen-2-yl)imidazolidin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,5-dioxo-4-propan-2-yl-4-thiophen-2-ylimidazolidin-1-yl)acetic acid (CAS 1274709-91-9) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: 2-(2,5-dioxo-4-propan-2-yl-4-thiophen-2-ylimidazolidin-1-yl)acetic acid. InChIKey: RWFACSVRRKQCRV-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 2-(2,5-dioxo-4-propan-2-yl-4-thiophen-2-ylimidazolidin-1-yl)acetic acid |
| InChIKey | RWFACSVRRKQCRV-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)N(C(=O)N1)CC(=O)O)C2=CC=CS2 |
Computed by PubChem (NCBI)