CAS 1094350-52-3 appears in our catalog under these names: 7-Iodo-2,3,4,5-tetrahydro-1-benzoxepin-5-one, 95%, 7-Iodo-2,3,4,5-tetrahydro-1-benzoxepin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
7-iodo-3,4-dihydro-2H-1-benzoxepin-5-one (CAS 1094350-52-3) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: 7-iodo-3,4-dihydro-2H-1-benzoxepin-5-one. InChIKey: LTPGNYMQIMPGIX-UHFFFAOYSA-N.
| Molecular formula | C10H9IO2 |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | 7-iodo-3,4-dihydro-2H-1-benzoxepin-5-one |
| InChIKey | LTPGNYMQIMPGIX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C2)I)OC1 |
Computed by PubChem (NCBI)