CAS 2374119-31-8 is the registry number for Benzoic acid, 4-(1-iodoethenyl)-, methyl ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(1-iodoethenyl)benzoate (CAS 2374119-31-8) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: methyl 4-(1-iodoethenyl)benzoate. InChIKey: BPDNMWCIEBCQKW-UHFFFAOYSA-N.
| Molecular formula | C10H9IO2 |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | methyl 4-(1-iodoethenyl)benzoate |
| InChIKey | BPDNMWCIEBCQKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=C)I |
Computed by PubChem (NCBI)