Products 2592405-65-5

CAS 2592405-65-5 is the registry number for 3-Cyclopropyl-5-iodobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyclopropyl-5-iodobenzoic acid (CAS 2592405-65-5) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: 3-cyclopropyl-5-iodobenzoic acid. InChIKey: IGHLYDAEUKZZEX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO2
Molecular weight288.08 g/mol
IUPAC name3-cyclopropyl-5-iodobenzoic acid
InChIKeyIGHLYDAEUKZZEX-UHFFFAOYSA-N
SMILESC1CC1C2=CC(=CC(=C2)I)C(=O)O

Computed by PubChem (NCBI)