CAS 2600372-45-8 is the registry number for 2-Iodo-4-vinylphenyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-ethenyl-2-iodophenyl) acetate (CAS 2600372-45-8) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: (4-ethenyl-2-iodophenyl) acetate. InChIKey: WJNWNWLIEUSOOG-UHFFFAOYSA-N.
| Molecular formula | C10H9IO2 |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | (4-ethenyl-2-iodophenyl) acetate |
| InChIKey | WJNWNWLIEUSOOG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=C)I |
Computed by PubChem (NCBI)