Products 2600372-45-8

CAS 2600372-45-8 is the registry number for 2-Iodo-4-vinylphenyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-ethenyl-2-iodophenyl) acetate (CAS 2600372-45-8) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: (4-ethenyl-2-iodophenyl) acetate. InChIKey: WJNWNWLIEUSOOG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO2
Molecular weight288.08 g/mol
IUPAC name(4-ethenyl-2-iodophenyl) acetate
InChIKeyWJNWNWLIEUSOOG-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C=C(C=C1)C=C)I

Computed by PubChem (NCBI)