CAS 1391118-96-9 is the registry number for 4-Iodo-7-methoxyindan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-iodo-7-methoxy-2,3-dihydroinden-1-one (CAS 1391118-96-9) is a chemical compound with the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. IUPAC name: 4-iodo-7-methoxy-2,3-dihydroinden-1-one. InChIKey: OCJBUXFIDXIPLZ-UHFFFAOYSA-N.
| Molecular formula | C10H9IO2 |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | 4-iodo-7-methoxy-2,3-dihydroinden-1-one |
| InChIKey | OCJBUXFIDXIPLZ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)I)CCC2=O |
Computed by PubChem (NCBI)