CAS 1094354-48-9 appears in our catalog under these names: 6-Chloro-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridazine, 95%, 6-Chloro-3-(2-fluorophenyl)-(1,2,4)triazolo(4,3-b)pyridazine, 98%, 6-Chloro-3-(2-fluorophenyl)-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
6-chloro-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1094354-48-9) is a chemical compound with the molecular formula C11H6ClFN4 and a molecular weight of 248.64 g/mol. IUPAC name: 6-chloro-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: LLGBCOHTUHFRBO-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN4 |
|---|---|
| Molecular weight | 248.64 g/mol |
| IUPAC name | 6-chloro-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | LLGBCOHTUHFRBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C3N2N=C(C=C3)Cl)F |
Computed by PubChem (NCBI)